| Product Name | 4-chloro-1-methyl-1H-pyrazole-3-carbaldehyde |
| CAS No. | 175204-81-6 |
| InChI | InChI=1/C5H5ClN2O/c1-8-2-4(6)5(3-9)7-8/h2-3H,1H3 |
| Molecular Formula | C5H5ClN2O |
| Molecular Weight | 144.559 |
| Density | 1.37g/cm3 |
| Melting point | 83℃ |
| Boiling point | 251.6°C at 760 mmHg |
| Flash point | 106°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175204-81-6 4-chloro-1-methyl-1h-pyrazole-3-carbaldehyde
service@apichina.com