| Product Name | 4-chloro-1,3-dimethyl-1H-pyrazolo[3,4-b]pyridine-5-carbonyl chloride |
| CAS No. | 175201-95-3 |
| InChI | InChI=1/C9H7Cl2N3O/c1-4-6-7(10)5(8(11)15)3-12-9(6)14(2)13-4/h3H,1-2H3 |
| Molecular Formula | C9H7Cl2N3O |
| Molecular Weight | 244.0774 |
| Density | 1.57g/cm3 |
| Melting point | 106℃ |
| Boiling point | 365.1°C at 760 mmHg |
| Flash point | 174.6°C |
| Refractive index | 1.682 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
175201-95-3 4-chloro-1,3-dimethyl-1h-pyrazolo[3,4-b]pyridine-5-carbonyl chloride
service@apichina.com