| Product Name | 4-butylphenyl isocyanate |
| CAS No. | 69342-47-8 |
| Synonyms | 4-n-Butylphenyl isocyanate; 4-Isocyanatophenylbutane; 1-butyl-4-isocyanatobenzene |
| InChI | InChI=1/C11H13NO/c1-2-3-4-10-5-7-11(8-6-10)12-9-13/h5-8H,2-4H2,1H3 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.227 |
| Density | 0.96g/cm3 |
| Boiling point | 246.7°C at 760 mmHg |
| Flash point | 88.3°C |
| Refractive index | 1.509 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
69342-47-8 4-butylphenyl isocyanate
service@apichina.com