| Product Name | 4-butoxyphenylacetic acid |
| CAS No. | 4547-57-3 |
| Synonyms | 4-(n-Butoxy)phenylacetic acid; (4-butoxyphenyl)acetate |
| InChI | InChI=1/C12H16O3/c1-2-3-8-15-11-6-4-10(5-7-11)9-12(13)14/h4-7H,2-3,8-9H2,1H3,(H,13,14)/p-1 |
| Molecular Formula | C12H15O3 |
| Molecular Weight | 207.2462 |
| Boiling point | 345°C at 760 mmHg |
| Flash point | 130.1°C |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4547-57-3 4-butoxyphenylacetic acid
service@apichina.com