| Product Name | 4-(Bromomethyl)phenoxyacetic acid |
| CAS No. | 126771-41-3 |
| InChI | InChI=1/C9H9BrO3/c10-5-7-1-3-8(4-2-7)13-6-9(11)12/h1-4H,5-6H2,(H,11,12) |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 |
| Density | 1.59g/cm3 |
| Boiling point | 363°C at 760 mmHg |
| Flash point | 173.3°C |
| Refractive index | 1.587 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
126771-41-3 4-(bromomethyl)phenoxyacetic acid
service@apichina.com