| Product Name | 4-Bromobenzyl chloride |
| CAS No. | 589-17-3 |
| Synonyms | 4-Bromo-alpha-chlorotoluene; 1-Bromo-4-(chloromethyl)-benzene; p-Bromobenzyl chloride |
| InChI | InChI=1/C7H6BrCl/c8-7-3-1-6(5-9)2-4-7/h1-4H,5H2 |
| Molecular Formula | C7H6BrCl |
| Molecular Weight | 205.4795 |
| Density | 1.541g/cm3 |
| Melting point | 36-40℃ |
| Boiling point | 236°C at 760 mmHg |
| Flash point | 111.7°C |
| Refractive index | 1.569 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; R36/37:Irritating to eyes and respiratory system.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
589-17-3 4-bromobenzyl chloride
service@apichina.com