| Product Name | 4-Bromobenzoic acid ethyl ester |
| CAS No. | 26496-94-6 |
| Synonyms | Ethyl 4-(bromomethyl)benzoate; 4-(Bromomethyl)benzoic acid ethyl ester~4-Ethoxycarbonylbenzyl bromide |
| InChI | InChI=1/C10H11BrO2/c1-2-13-10(12)9-5-3-8(7-11)4-6-9/h3-6H,2,7H2,1H3 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.0971 |
| Density | 1.402g/cm3 |
| Boiling point | 302.8°C at 760 mmHg |
| Flash point | 136.9°C |
| Refractive index | 1.551 |
| Risk Codes | R22:Harmful if swallowed.; R34:Causes burns.; R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
26496-94-6 4-bromobenzoic acid ethyl ester
service@apichina.com