| Product Name | 4-Bromobenzhydrazide |
| CAS No. | 5933-32-4 |
| Synonyms | 4-Bromobenzoic hydrazide; 4-bromobenzohydrazide |
| InChI | InChI=1/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| Molecular Formula | C7H7BrN2O |
| Molecular Weight | 215.0473 |
| Density | 1.615g/cm3 |
| Melting point | 165-167℃ |
| Boiling point | 353.2°C at 760 mmHg |
| Flash point | 167.4°C |
| Refractive index | 1.615 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
5933-32-4 4-bromobenzhydrazide
service@apichina.com