| Product Name | 4-Bromobenzeneboronic acid neopentyl glycol cyclic ester |
| CAS No. | 183677-71-6 |
| Synonyms | 2-(4-Bromophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChI | InChI=1/C11H14BBrO2/c1-11(2)7-14-12(15-8-11)9-3-5-10(13)6-4-9/h3-6H,7-8H2,1-2H3 |
| Molecular Formula | C11H14BBrO2 |
| Molecular Weight | 268.9427 |
| Density | 1.335g/cm3 |
| Boiling point | 331.039°C at 760 mmHg |
| Flash point | 154.007°C |
| Refractive index | 1.533 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
183677-71-6 4-bromobenzeneboronic acid neopentyl glycol cyclic ester
service@apichina.com