| Product Name | 4-Bromobenzeneboronic acid N-methyldiethanolamine cyclic ester |
| CAS No. | 133468-58-3 |
| Synonyms | 2-(4-bromophenyl)-6-methyl-1,3,6,2-dioxazaborocane |
| InChI | InChI=1/C11H15BBrNO2/c1-14-6-8-15-12(16-9-7-14)10-2-4-11(13)5-3-10/h2-5H,6-9H2,1H3 |
| Molecular Formula | C11H15BBrNO2 |
| Molecular Weight | 283.9573 |
| Density | 1.368g/cm3 |
| Boiling point | 364.719°C at 760 mmHg |
| Flash point | 174.376°C |
| Refractive index | 1.553 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
133468-58-3 4-bromobenzeneboronic acid n-methyldiethanolamine cyclic ester
service@apichina.com