Product Name | 4-Bromobenzamide |
CAS No. | 698-67-9 |
Synonyms | 4-Bromobenzamide,97%; p-bromo-benzamid; p-bromobenzoicacidamide; P-BROMOBENZAMIDE |
InChI | InChI=1/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
Molecular Formula | C7H6BrNO |
Molecular Weight | 200.0326 |
Density | 1.609g/cm3 |
Melting point | 189-194℃ |
Boiling point | 309.9°C at 760 mmHg |
Flash point | 141.2°C |
Refractive index | 1.605 |
Hazard Symbols | |
Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
698-67-9 4-bromobenzamide
service@apichina.com