| Product Name | 4-Bromobenzamide |
| CAS No. | 698-67-9 |
| Synonyms | 4-Bromobenzamide,97%; p-bromo-benzamid; p-bromobenzoicacidamide; P-BROMOBENZAMIDE |
| InChI | InChI=1/C7H6BrNO/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H2,9,10) |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.0326 |
| Density | 1.609g/cm3 |
| Melting point | 189-194℃ |
| Boiling point | 309.9°C at 760 mmHg |
| Flash point | 141.2°C |
| Refractive index | 1.605 |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
698-67-9 4-bromobenzamide
service@apichina.com