| Product Name | 4-Bromo-N,N-diethylaniline |
| CAS No. | 2052-06-4 |
| Synonyms | Benzenamine, 4-bromo-N,N-diethyl-; N,N-Diethyl-p-bromoaniline; NSC 8071; p-Bromo-N,N-diethylaniline; Aniline, p-bromo-N,N-diethyl- (8CI); p-N,Nddiethylaniline |
| InChI | InChI=1/C10H14BrN/c1-3-12(4-2)10-7-5-9(11)6-8-10/h5-8H,3-4H2,1-2H3 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.1289 |
| Density | 1.291g/cm3 |
| Boiling point | 270°C at 760 mmHg |
| Flash point | 125.1°C |
| Refractive index | 1.564 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
2052-06-4 4-bromo-n,n-diethylaniline
service@apichina.com