| Product Name | 4-Bromo-3-nitrobiphenyl |
| CAS No. | 27701-66-2 |
| InChI | InChI=1/C12H8BrNO2/c13-11-7-6-10(8-12(11)14(15)16)9-4-2-1-3-5-9/h1-8H |
| Molecular Formula | C12H8BrNO2 |
| Molecular Weight | 278.1014 |
| Density | 1.521g/cm3 |
| Melting point | 39℃ |
| Boiling point | 354.1°C at 760 mmHg |
| Flash point | 168°C |
| Refractive index | 1.63 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
27701-66-2 4-bromo-3-nitrobiphenyl
service@apichina.com