| Product Name | 4-bromo-3-nitroanisole |
| CAS No. | 10079-53-5;5344-78-5 |
| Synonyms | 4-BROMO-3-NITROTHIOANISOLE; TIMTEC-BB SBB009974; 1-bromo-4-methoxy-2-nitrobenzene |
| InChI | InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| Molecular Formula | C7H6BrNO3 |
| Molecular Weight | 232.0314 |
| Density | 1.64g/cm3 |
| Melting point | 32-34℃ |
| Boiling point | 291°C at 760 mmHg |
| Flash point | 123°C |
| Refractive index | 1.581 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10079-53-5;5344-78-5 4-bromo-3-nitroanisole
service@apichina.com