| Product Name | 4-Bromo-3-methylbenzoyl chloride |
| CAS No. | 21900-25-4 |
| InChI | InChI=1/C8H6BrClO/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4H,1H3 |
| Molecular Formula | C8H6BrClO |
| Molecular Weight | 233.4896 |
| Density | 1.574g/cm3 |
| Boiling point | 276.7°C at 760 mmHg |
| Flash point | 121.2°C |
| Refractive index | 1.575 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
21900-25-4 4-bromo-3-methylbenzoyl chloride
service@apichina.com