| Product Name | 4-Bromo-3-methoxyaniline |
| CAS No. | 19056-40-7 |
| Synonyms | 4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
| InChI | InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.2295 |
| Density | 1.381g/cm3 |
| Boiling point | 467°C at 760 mmHg |
| Flash point | 236.2°C |
| Refractive index | 1.655 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
19056-40-7 4-bromo-3-methoxyaniline
service@apichina.com