| Product Name | 4-Bromo-3-fluorobenzeneboronic acid |
| CAS No. | 374790-97-3 |
| Synonyms | 4-Bromo-3-fluorophenylboronic acid |
| InChI | InChI=1/C6H5BBrFO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H |
| Molecular Formula | C6H5BBrFO2 |
| Molecular Weight | 218.8161 |
| Density | 1.75g/cm3 |
| Boiling point | 314.7°C at 760 mmHg |
| Flash point | 144.1°C |
| Refractive index | 1.571 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374790-97-3 4-bromo-3-fluorobenzeneboronic acid
service@apichina.com