| Product Name | 4-Bromo-3-chlorophenol |
| CAS No. | 13631-21-5 |
| InChI | InChI=1/C6H4BrClO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H |
| Molecular Formula | C6H4BrClO |
| Molecular Weight | 207.4524 |
| Density | 1.788g/cm3 |
| Boiling point | 267.5°C at 760 mmHg |
| Flash point | 115.6°C |
| Refractive index | 1.619 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13631-21-5 4-bromo-3-chlorophenol
service@apichina.com