| Product Name | (4-bromo-2-thienyl)methanol |
| CAS No. | 79757-77-0 |
| Synonyms | (4-bromothiophen-2-yl)methanol; (4-Bromothien-2-yl)methanol |
| InChI | InChI=1/C5H5BrOS/c6-4-1-5(2-7)8-3-4/h1,3,7H,2H2 |
| Molecular Formula | C5H5BrOS |
| Molecular Weight | 193.0616 |
| Density | 1.773g/cm3 |
| Boiling point | 271.491°C at 760 mmHg |
| Flash point | 117.994°C |
| Refractive index | 1.631 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
79757-77-0 (4-bromo-2-thienyl)methanol
service@apichina.com