| Product Name | 4-Bromo-2-methylphenyl isothiocyanate |
| CAS No. | 19241-38-4 |
| Synonyms | 4-Bromo-2-methylisothiocyanatobenzene; 4-bromo-1-isothiocyanato-2-methylbenzene; 1-bromo-4-isothiocyanato-2-methylbenzene |
| InChI | InChI=1/C8H6BrNS/c1-6-4-7(10-5-11)2-3-8(6)9/h2-4H,1H3 |
| Molecular Formula | C8H6BrNS |
| Molecular Weight | 228.1089 |
| Density | 1.44g/cm3 |
| Boiling point | 307.9°C at 760 mmHg |
| Flash point | 140°C |
| Refractive index | 1.608 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
19241-38-4 4-bromo-2-methylphenyl isothiocyanate
service@apichina.com