| Product Name | 4-bromo-2-methylphenyl isocyanate |
| CAS No. | 1591-98-6 |
| Synonyms | 4-Bromo-2-methylisocyanatobenzene; 4-bromo-1-isocyanato-2-methylbenzene |
| InChI | InChI=1/C8H6BrNO/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
| Molecular Formula | C8H6BrNO |
| Molecular Weight | 212.0433 |
| Density | 1.44g/cm3 |
| Melting point | 47-50℃ |
| Boiling point | 254.7°C at 760 mmHg |
| Flash point | 107.9°C |
| Refractive index | 1.571 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1591-98-6 4-bromo-2-methylphenyl isocyanate
service@apichina.com