| Product Name | 4-bromo-2-chlorophenyl isothiocyanate |
| CAS No. | 98041-69-1 |
| Synonyms | 4-Bromo-2-chloroisothiocyanatobenzene; 1-bromo-2-chloro-4-isothiocyanatobenzene; 4-bromo-2-chloro-1-isothiocyanatobenzene |
| InChI | InChI=1/C7H3BrClNS/c8-5-1-2-7(10-4-11)6(9)3-5/h1-3H |
| Molecular Formula | C7H3BrClNS |
| Molecular Weight | 248.5274 |
| Density | 1.63g/cm3 |
| Melting point | 46-48℃ |
| Boiling point | 315.2°C at 760 mmHg |
| Flash point | 144.4°C |
| Refractive index | 1.641 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
98041-69-1 4-bromo-2-chlorophenyl isothiocyanate
service@apichina.com