| Product Name | 4-Bromo-2-chloro-1-iodobenzene |
| CAS No. | 31928-47-9 |
| Synonyms | 4-Bromo-2-chloroiodobenzene; 1-Bromo-3-chloro-4-iodobenzene |
| InChI | InChI=1/C6H3BrClI/c7-4-1-2-6(9)5(8)3-4/h1-3H |
| Molecular Formula | C6H3BrClI |
| Molecular Weight | 317.3495 |
| Density | 2.272g/cm3 |
| Boiling point | 281.2°C at 760 mmHg |
| Flash point | 123.8°C |
| Refractive index | 1.663 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
31928-47-9 4-bromo-2-chloro-1-iodobenzene
service@apichina.com