| Product Name | 4-Bromo-2,6-dimethylphenyl isocyanate |
| CAS No. | 77159-76-3 |
| Synonyms | 5-bromo-2-isocyanato-1,3-dimethylbenzene |
| InChI | InChI=1/C9H8BrNO/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3 |
| Molecular Formula | C9H8BrNO |
| Molecular Weight | 226.0699 |
| Density | 1.39g/cm3 |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 123.5°C |
| Refractive index | 1.563 |
| Risk Codes | R23/25:Toxic by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
77159-76-3 4-bromo-2,6-dimethylphenyl isocyanate
service@apichina.com