| Product Name | 4-Bromo-2,6-dimethylisothiocyanatobenzene |
| CAS No. | 32265-82-0 |
| Synonyms | 4-Bromo-2,6-dimethylphenyl isothiocyanate; 5-bromo-2-isothiocyanato-1,3-dimethylbenzene |
| InChI | InChI=1/C9H8BrNS/c1-6-3-8(10)4-7(2)9(6)11-5-12/h3-4H,1-2H3 |
| Molecular Formula | C9H8BrNS |
| Molecular Weight | 242.1355 |
| Density | 1.39g/cm3 |
| Boiling point | 321.2°C at 760 mmHg |
| Flash point | 148.1°C |
| Refractive index | 1.597 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
32265-82-0 4-bromo-2,6-dimethylisothiocyanatobenzene
service@apichina.com