| Product Name | 4-Bromo-2,5-difluorobenzenesulphonyl chloride |
| CAS No. | 207974-14-9 |
| Synonyms | 4-bromo-2,5-difluorobenzenesulfonyl chloride; 3,4-dihydro-2H-chromen-2-ylmethanol; 1,3-difluoro-2-isothiocyanatobenzene |
| InChI | InChI=1/C7H3F2NS/c8-5-2-1-3-6(9)7(5)10-4-11/h1-3H |
| Molecular Formula | C7H3F2NS |
| Molecular Weight | 171.1672 |
| Density | 1.26g/cm3 |
| Melting point | 37℃ |
| Boiling point | 221.6°C at 760 mmHg |
| Flash point | 87.8°C |
| Refractive index | 1.536 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
207974-14-9 4-bromo-2,5-difluorobenzenesulphonyl chloride
service@apichina.com