| Product Name | 4-Bromo-2,3-dimethyl-6-nitroaniline |
| CAS No. | 108485-13-8 |
| Synonyms | 4-Bromo-6-nitro-2,3-xylidine |
| InChI | InChI=1/C8H9BrN2O2/c1-4-5(2)8(10)7(11(12)13)3-6(4)9/h3H,10H2,1-2H3 |
| Molecular Formula | C8H9BrN2O2 |
| Molecular Weight | 245.0733 |
| Density | 1.609g/cm3 |
| Boiling point | 357.9°C at 760 mmHg |
| Flash point | 170.3°C |
| Refractive index | 1.632 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
108485-13-8 4-bromo-2,3-dimethyl-6-nitroaniline
service@apichina.com