| Product Name | 4-Bromo-2,3-difluorobenzeneboronic acid |
| CAS No. | 374790-99-5 |
| Synonyms | 4-Bromo-2,3-difluorophenylboronic acid |
| InChI | InChI=1/C6H4BBrF2O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| Molecular Formula | C6H4BBrF2O2 |
| Molecular Weight | 236.8066 |
| Density | 1.82g/cm3 |
| Boiling point | 312.6°C at 760 mmHg |
| Flash point | 142.8°C |
| Refractive index | 1.547 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
374790-99-5 4-bromo-2,3-difluorobenzeneboronic acid
service@apichina.com