| Product Name | 4-bromo-1H-pyrazole-3-carbonitrile |
| CAS No. | 288246-16-2 |
| Synonyms | 4-Bromo-3-cyano-1H-pyrazole; 4-bromo-1H-pyrazole-5-carbonitrile; 4-Bromo-2H-pyrazole-3-carbonitrile |
| InChI | InChI=1/C4H2BrN3/c5-3-2-7-8-4(3)1-6/h2H,(H,7,8) |
| Molecular Formula | C4H2BrN3 |
| Molecular Weight | 171.9828 |
| Density | 2.01g/cm3 |
| Melting point | 158℃ |
| Boiling point | 412.4°C at 760 mmHg |
| Flash point | 203.2°C |
| Refractive index | 1.639 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
288246-16-2 4-bromo-1h-pyrazole-3-carbonitrile
service@apichina.com