| Product Name | 4-bromo-1-ethyl-3-methyl-1H-pyrazole-5-carboxylic acid |
| CAS No. | 175276-99-0 |
| InChI | InChI=1/C7H9BrN2O2/c1-3-10-6(7(11)12)5(8)4(2)9-10/h3H2,1-2H3,(H,11,12) |
| Molecular Formula | C7H9BrN2O2 |
| Molecular Weight | 233.0626 |
| Density | 1.69g/cm3 |
| Melting point | 154℃ |
| Boiling point | 349.7°C at 760 mmHg |
| Flash point | 165.3°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175276-99-0 4-bromo-1-ethyl-3-methyl-1h-pyrazole-5-carboxylic acid
service@apichina.com