| Product Name | 4-bromo-1,3-dimethyl-1H-pyrazole-5-carboxylic acid |
| CAS No. | 5775-88-2 |
| InChI | InChI=1/C6H7BrN2O2/c1-3-4(7)5(6(10)11)9(2)8-3/h1-2H3,(H,10,11) |
| Molecular Formula | C6H7BrN2O2 |
| Molecular Weight | 219.036 |
| Density | 1.8g/cm3 |
| Melting point | 230℃ |
| Boiling point | 344°C at 760 mmHg |
| Flash point | 161.8°C |
| Refractive index | 1.636 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5775-88-2 4-bromo-1,3-dimethyl-1h-pyrazole-5-carboxylic acid
service@apichina.com