| Product Name | 4-bromo-1,3-benzodioxole |
| CAS No. | 6698-13-1 |
| Synonyms | 4-bromobenzo[d][1,3]dioxole |
| InChI | InChI=1/C7H5BrO2/c8-5-2-1-3-6-7(5)10-4-9-6/h1-3H,4H2 |
| Molecular Formula | C7H5BrO2 |
| Molecular Weight | 201.0174 |
| Density | 1.721g/cm3 |
| Boiling point | 238.258°C at 760 mmHg |
| Flash point | 109.652°C |
| Refractive index | 1.603 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6698-13-1 4-bromo-1,3-benzodioxole
service@apichina.com