| Product Name | 4-Borono-D-phenylalanine |
| CAS No. | 111821-49-9 |
| Synonyms | 4-(dihydroxyboranyl)-D-phenylalanine |
| InChI | InChI=1/C9H12BNO4/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4,8,14-15H,5,11H2,(H,12,13)/t8-/m1/s1 |
| Molecular Formula | C9H12BNO4 |
| Molecular Weight | 209.0069 |
| Density | 1.34g/cm3 |
| Boiling point | 449.3°C at 760 mmHg |
| Flash point | 225.5°C |
| Refractive index | 1.59 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
111821-49-9 4-borono-d-phenylalanine
service@apichina.com