| Product Name | 4-Benzylthiomorpholine 1,1-Dioxide |
| CAS No. | 26475-66-1 |
| Synonyms | 4-Benzylthiomorpholine 1,1-Dioxide; thiomorpholine, 4-(phenylmethyl)-, 1,1-dioxide |
| InChI | InChI=1/C11H15NO2S/c13-15(14)8-6-12(7-9-15)10-11-4-2-1-3-5-11/h1-5H,6-10H2 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.3073 |
| Density | 1.235g/cm3 |
| Melting point | 83℃ |
| Boiling point | 397.9°C at 760 mmHg |
| Flash point | 194.4°C |
| Refractive index | 1.578 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
26475-66-1 4-benzylthiomorpholine 1,1-dioxide
service@apichina.com