| Product Name | 4-Benzyloxyphenoxyacetic acid |
| CAS No. | 38559-92-1 |
| Synonyms | (4-(Phenylmethoxy)phenoxy)acetic acid |
| InChI | InChI=1/C15H14O4/c16-15(17)11-19-14-8-6-13(7-9-14)18-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,16,17) |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.2693 |
| Density | 1.234g/cm3 |
| Boiling point | 436.9°C at 760 mmHg |
| Flash point | 164.9°C |
| Refractive index | 1.586 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
38559-92-1 4-benzyloxyphenoxyacetic acid
service@apichina.com