| Product Name | 4-Benzyloxybenzonitrile |
| CAS No. | 52805-36-4 |
| InChI | InChI=1/C14H11NO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,11H2 |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.2432 |
| Density | 1.14g/cm3 |
| Boiling point | 374°C at 760 mmHg |
| Flash point | 157.6°C |
| Refractive index | 1.597 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
52805-36-4 4-benzyloxybenzonitrile
service@apichina.com