| Product Name | 4-Benzyloxy-2-hydroxybenzaldehyde |
| CAS No. | 52085-14-0 |
| Synonyms | 4-Benzyloxysalicylaldehyde; 4-(benzyloxy)-2-hydroxybenzaldehyde |
| InChI | InChI=1/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.2433 |
| Density | 1.238g/cm3 |
| Boiling point | 390.9°C at 760 mmHg |
| Flash point | 149.9°C |
| Refractive index | 1.636 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
52085-14-0 4-benzyloxy-2-hydroxybenzaldehyde
service@apichina.com