| Product Name | 4-Benzyloxy-2-fluorobenzeneboronic acid |
| CAS No. | 166744-78-1 |
| Synonyms | 4-Benzyloxy-2-fluorophenylboronic acid |
| InChI | InChI=1/C13H12BFO3/c15-13-8-11(6-7-12(13)14(16)17)18-9-10-4-2-1-3-5-10/h1-8,16-17H,9H2 |
| Molecular Formula | C13H12BFO3 |
| Molecular Weight | 246.042 |
| Density | 1.26g/cm3 |
| Melting point | 153℃ |
| Boiling point | 406.8°C at 760 mmHg |
| Flash point | 199.8°C |
| Refractive index | 1.577 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
166744-78-1 4-benzyloxy-2-fluorobenzeneboronic acid
service@apichina.com