| Product Name | 4-Benzyl-4-hydroxypiperidine |
| CAS No. | 51135-96-7 |
| Synonyms | 4-Benzyl-4-piperidinol; 4-benzylpiperidin-4-ol; 4-benzyl-4-hydroxypiperidinium |
| InChI | InChI=1/C12H17NO/c14-12(6-8-13-9-7-12)10-11-4-2-1-3-5-11/h1-5,13-14H,6-10H2/p+1 |
| Molecular Formula | C12H18NO |
| Molecular Weight | 192.2769 |
| Melting point | 80-85℃ |
| Boiling point | 329°C at 760 mmHg |
| Flash point | 128.4°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
51135-96-7 4-benzyl-4-hydroxypiperidine
service@apichina.com