| Product Name | 4-benzyl-2-morpholinecarbonyl chloride hydrochloride |
| CAS No. | 135072-14-9 |
| Synonyms | 4-benzylmorpholine-2-carbonyl chloride hydrochloride |
| InChI | InChI=1/C12H14ClNO2.ClH/c13-12(15)11-9-14(6-7-16-11)8-10-4-2-1-3-5-10;/h1-5,11H,6-9H2;1H |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.159 |
| Melting point | 100℃ |
| Boiling point | 324.1°C at 760 mmHg |
| Flash point | 149.8°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
135072-14-9 4-benzyl-2-morpholinecarbonyl chloride hydrochloride
service@apichina.com