| Product Name | 4-Benzyl-2-(bromoethyl)morpholine |
| CAS No. | 306935-00-2 |
| Synonyms | 4-Benzyl-2-(bromomethyl)morpholine; (2R)-4-benzyl-2-(bromomethyl)morpholin-4-ium; (2S)-4-benzyl-2-(bromomethyl)morpholin-4-ium |
| InChI | InChI=1/C12H16BrNO/c13-8-12-10-14(6-7-15-12)9-11-4-2-1-3-5-11/h1-5,12H,6-10H2/p+1/t12-/m1/s1 |
| Molecular Formula | C12H17BrNO |
| Molecular Weight | 271.1729 |
| Boiling point | 330.5°C at 760 mmHg |
| Flash point | 153.7°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306935-00-2 4-benzyl-2-(bromoethyl)morpholine
service@apichina.com