| Product Name | (4-Aminophenylthio)acetic acid |
| CAS No. | 104-18-7 |
| Synonyms | 2-(4-Aminophenylthio)acetic acid; 4-Aminothiophenoxyacetic acid; [(4-aminophenyl)sulfanyl]acetic acid; [(4-aminophenyl)sulfanyl]acetate |
| InChI | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| Molecular Formula | C8H8NO2S |
| Molecular Weight | 182.2202 |
| Boiling point | 405.3°C at 760 mmHg |
| Flash point | 198.9°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
104-18-7 (4-aminophenylthio)acetic acid
service@apichina.com