| Product Name | 4-Aminomethylphenylboronic acid hydrochloride |
| CAS No. | 75705-21-4 |
| Synonyms | [4-(aminomethyl)phenyl]boronic acid |
| InChI | InChI=1/C7H10BNO2/c9-5-6-1-3-7(4-2-6)8(10)11/h1-4,10-11H,5,9H2 |
| Molecular Formula | C7H10BNO2 |
| Molecular Weight | 150.9708 |
| Density | 1.18g/cm3 |
| Boiling point | 337.7°C at 760 mmHg |
| Flash point | 158.1°C |
| Refractive index | 1.567 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
75705-21-4 4-aminomethylphenylboronic acid hydrochloride
service@apichina.com