| Product Name | 4-Aminodiphenylmethane |
| CAS No. | 1135-12-2 |
| Synonyms | 4-Benzylaniline; 1,1,2,2-tetramethyl-3,4-di(propan-2-ylidene)cyclobutane |
| InChI | InChI=1/C13H13N/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9H,10,14H2 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.249 |
| Density | 1.07g/cm3 |
| Boiling point | 300°C at 760 mmHg |
| Flash point | 159.5°C |
| Refractive index | 1.616 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1135-12-2 4-aminodiphenylmethane
service@apichina.com