| Product Name | 4-Amino-5-chloro-2-methoxybenzoic acid |
| CAS No. | 7206-70-4 |
| Synonyms | 4-amino-5-chloro-2-methoxybenzoate |
| InChI | InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
| Molecular Formula | C8H7ClNO3 |
| Molecular Weight | 200.5996 |
| Melting point | 206-210℃ |
| Boiling point | 369.7°C at 760 mmHg |
| Flash point | 177.4°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; |
| Safety | S28B:After contact with skin, wash immediately with plenty of water and soap.; S38:In case of insufficient ventilation, wear suitable respiratory equipment.; |
7206-70-4 4-amino-5-chloro-2-methoxybenzoic acid
service@apichina.com