| Product Name | 4-Amino-4-carboxytetrahydrothiopyran hydrochloride |
| CAS No. | 67639-41-2 |
| Synonyms | 4-Aminotetrahydro-2H-thiopyran-4-carboxylic acid hydrochloride; 4-aminotetrahydro-2H-thiopyran-4-carboxylic acid |
| InChI | InChI=1/C6H11NO2S/c7-6(5(8)9)1-3-10-4-2-6/h1-4,7H2,(H,8,9) |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.222 |
| Density | 1.298g/cm3 |
| Boiling point | 334.7°C at 760 mmHg |
| Flash point | 156.2°C |
| Refractive index | 1.57 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
67639-41-2 4-amino-4-carboxytetrahydrothiopyran hydrochloride
service@apichina.com