| Product Name | 4-Amino-3-methylbenzonitrile |
| CAS No. | 78881-21-7 |
| Synonyms | 4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
| InChI | InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.1625 |
| Density | 1.1g/cm3 |
| Boiling point | 304.5°C at 760 mmHg |
| Flash point | 138°C |
| Refractive index | 1.575 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
78881-21-7 4-amino-3-methylbenzonitrile
service@apichina.com