| Product Name | 4-Amino-3-ethylbenzonitrile |
| CAS No. | 170230-87-2 |
| Synonyms | 4-Cyano-2-ethylaniline |
| InChI | InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.1891 |
| Density | 1.07g/cm3 |
| Boiling point | 297.1°C at 760 mmHg |
| Flash point | 133.5°C |
| Refractive index | 1.562 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
170230-87-2 4-amino-3-ethylbenzonitrile
service@apichina.com