| Product Name | 4-Amino-3-chloro-5-methylbenzonitrile |
| CAS No. | 158296-69-6 |
| Synonyms | 2-Chloro-4-cyano-6-methylaniline |
| InChI | InChI=1/C8H7ClN2/c1-5-2-6(4-10)3-7(9)8(5)11/h2-3H,11H2,1H3 |
| Molecular Formula | C8H7ClN2 |
| Molecular Weight | 166.6076 |
| Density | 1.27g/cm3 |
| Boiling point | 302°C at 760 mmHg |
| Flash point | 136.5°C |
| Refractive index | 1.594 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
158296-69-6 4-amino-3-chloro-5-methylbenzonitrile
service@apichina.com