| Product Name | 4-amino-2-piperidino-5-pyrimidinecarbonitrile |
| CAS No. | 90973-23-2 |
| InChI | InChI=1/C10H13N5/c11-6-8-7-13-10(14-9(8)12)15-4-2-1-3-5-15/h7H,1-5H2,(H2,12,13,14) |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.2437 |
| Density | 1.27g/cm3 |
| Melting point | 220℃ |
| Boiling point | 457.1°C at 760 mmHg |
| Flash point | 230.2°C |
| Refractive index | 1.615 |
| Hazard Symbols | |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
90973-23-2 4-amino-2-piperidino-5-pyrimidinecarbonitrile
service@apichina.com